
Catalog Number	AR00G92F
Chemical Name	Przewaquinone A
CAS Number	76843-23-7
Molecular Formula	C19H18O4
Molecular Weight	310.3438
MDL Number	MFCD21333242
SMILES	OCc1coc2-c3c(C(=O)C(=O)c12)c1CCCC(c1cc3)(C)C

Przewaquinone A is a highly versatile and valuable compound in the field of chemical synthesis. This unique molecule serves as a key building block in the creation of various pharmaceuticals, agrochemicals, and organic materials. Its structural properties enable it to participate in a wide range of reactions, making it a valuable tool for synthetic chemists seeking to design and construct complex molecular structures. Przewaquinone A is particularly valued for its ability to undergo oxidative transformations, facilitating the synthesis of diverse compounds with potent biological activities. Additionally, its functional groups can be selectively modified to fine-tune its reactivity and compatibility with specific synthetic routes. Overall, the use of Przewaquinone A in chemical synthesis actively contributes to the advancement of drug discovery, materials science, and other areas of research requiring the precise manipulation of molecular structures.