
Catalog Number	AR00G4GL
Chemical Name	SOLITHROMYCIN
CAS Number	760981-83-7
Molecular Formula	C43H65FN6O10
Molecular Weight	845.0088
MDL Number	MFCD28411434
SMILES	CC[C@H]1OC(=O)[C@@](C)(F)C(=O)[C@H](C)[C@@H](O[C@@H]2O[C@H](C)C[C@@H]([C@H]2O)N(C)C)[C@](C[C@H](C(=O)[C@@H]([C@@H]2[C@]1(C)OC(=O)N2CCCCn1nnc(c1)c1cccc(c1)N)C)C)(C)OC

Solithromycin is a highly versatile compound that finds valuable application in chemical synthesis, particularly in the development of novel pharmaceuticals and bioactive molecules. Due to its unique chemical structure and antibiotic properties, Solithromycin serves as a key building block in organic synthesis, enabling the creation of structurally diverse and complex compounds. By incorporating Solithromycin into synthetic pathways, chemists can access a wide range of chemical transformations and functional group modifications, leading to the generation of new drug candidates and therapeutic agents. The selective reactivity and pharmacological profile of Solithromycin make it a valuable tool in the toolbox of synthetic chemists, offering opportunities to explore innovative synthetic strategies and expand the frontiers of chemical research.