
Catalog Number	AR00G3LV
Chemical Name	(4'-Methoxy-biphenyl-3-yl)-acetic acid
CAS Number	75852-49-2
Molecular Formula	C15H14O3
Molecular Weight	242.2699
MDL Number	MFCD01740450
SMILES	COc1ccc(cc1)c1cccc(c1)CC(=O)O

2-(4'-Methoxy-[1,1'-biphenyl]-3-yl)acetic acid is a versatile compound widely utilized in chemical synthesis for its unique properties and reactivity. As a precursor in organic reactions, this compound serves as a key building block for the synthesis of various pharmaceuticals, agrochemicals, and functional materials.In organic synthesis, 2-(4'-Methoxy-[1,1'-biphenyl]-3-yl)acetic acid is commonly employed as a starting material for the preparation of complex organic molecules due to its functional groups and structural moieties. Its biphenyl backbone provides rigidity and stability, making it a valuable scaffold in the design of molecular architectures with specific stereochemical and electronic properties.Furthermore, the presence of the methoxy group on the biphenyl ring enhances the compound's solubility and modulates its chemical reactivity, enabling selective functionalization at different positions. By utilizing 2-(4'-Methoxy-[1,1'-biphenyl]-3-yl)acetic acid as a building block, chemists can access a diverse range of derivatives through tailored synthetic routes, thus facilitating the development of novel compounds for various applications in the field of medicinal chemistry, materials science, and beyond.