
Catalog Number	AR00G6Q5
Chemical Name	kuwanon G
CAS Number	75629-19-5
Molecular Formula	C40H36O11
Molecular Weight	692.7072400000002
MDL Number	MFCD05662262
SMILES	C/C(=C\Cc1c(oc2c(c1=O)c(O)cc(c2[C@H]1C=C(C)C[C@H]([C@@H]1C(=O)c1ccc(cc1O)O)c1ccc(cc1O)O)O)c1ccc(cc1O)O)/C

Kuwanon G is a naturally occurring compound found in the root bark of the mulberry tree. Its unique chemical properties make it a valuable tool in chemical synthesis, particularly in the field of organic chemistry.One notable application of Kuwanon G in chemical synthesis is its role as a precursor in the production of various bioactive compounds. Through various chemical reactions, Kuwanon G can be transformed into derivatives with enhanced pharmacological properties, making it a promising starting material for the synthesis of pharmaceuticals and other biologically active molecules.Additionally, Kuwanon G has been investigated for its potential use in the development of novel materials. By modifying its chemical structure, researchers have been able to create polymers and other materials with specialized properties, such as improved durability or conductivity. This versatility makes Kuwanon G a valuable building block in the creation of new materials for various applications.Overall, Kuwanon G's unique chemical structure and reactivity make it a versatile tool in chemical synthesis, with potential applications in both the pharmaceutical and materials science industries.