
Catalog Number	AR005CL7
Chemical Name	O-ACETYL-L-HOMOSERINE HYDROCHLORIDE
CAS Number	7540-67-2
Molecular Formula	C6H12ClNO4
Molecular Weight	197.6168
MDL Number	MFCD07357497
SMILES	CC(=O)OCC[C@@H](C(=O)O)N.Cl

O-Acetyl-L-homoserine is a crucial intermediate in chemical synthesis, commonly utilized in the production of various important compounds. This compound plays a significant role in the formation of peptide bonds and is a key building block in the synthesis of peptides and proteins. Furthermore, O-Acetyl-L-homoserine serves as a precursor in the biosynthesis of essential amino acids, illustrating its importance in the creation of key biochemical molecules. In addition, it is a valuable tool in organic chemistry reactions, serving as a versatile starting material for the preparation of diverse organic compounds. Its unique structure and reactivity make O-Acetyl-L-homoserine a valuable asset in chemical synthesis, facilitating the creation of complex molecules with precision and efficiency.