
Catalog Number	AR0056SF
Chemical Name	Butanoic acid, 2-amino-, 1,1-dimethylethyl ester, (2S)-
CAS Number	75190-94-2
Molecular Formula	C8H17NO2
Molecular Weight	159.2261
MDL Number	MFCD20547738
SMILES	CC[C@@H](C(=O)OC(C)(C)C)N

Butanoic acid, 2-amino-, 1,1-dimethylethyl ester, (2S)- is a key compound used in chemical synthesis for its versatile applications. In organic chemistry, this compound is commonly employed as a building block for the synthesis of various pharmaceuticals and agrochemicals. Due to its unique structure and reactivity, it serves as a valuable intermediate in the production of complex molecules. Furthermore, its chirality (the presence of a stereocenter) as the (2S)- enantiomer is crucial in the creation of enantioselective compounds, making it highly sought after in asymmetric synthesis. Its role in chemical reactions contributes to the development of novel materials and compounds with specific optical and biological properties.