
Catalog Number	AR00G41X
Chemical Name	PRE-084
CAS Number	75136-54-8
Molecular Formula	C19H28ClNO3
Molecular Weight	353.8835199999999
MDL Number	MFCD00673883
SMILES	O=C(C1(CCCCC1)c1ccccc1)OCCN1CCOCC1.Cl

PRE-084 hydrochloride is a potent and selective σ1 receptor agonist commonly utilized in chemical synthesis processes. This compound is known for its ability to modulate various cellular functions and signaling pathways, making it a valuable tool in the development of new drugs and therapeutic agents. In chemical synthesis, PRE-084 hydrochloride is often employed as a key reagent in the creation of novel organic compounds and pharmaceuticals. Its unique pharmacological properties allow researchers to manipulate σ1 receptor activity, facilitating the study of neurological disorders, pain management, and other biological processes. By incorporating PRE-084 hydrochloride into synthetic pathways, chemists can effectively target specific biological pathways and receptors, leading to the discovery of new drug candidates and therapeutic strategies. With its diverse applications and versatile nature, PRE-084 hydrochloride serves as a valuable asset in the field of chemical synthesis and pharmaceutical research.