
Catalog Number	AR00FIHJ
Chemical Name	NSC402465
CAS Number	7470-88-4
Molecular Formula	C12H11NO
Molecular Weight	185.22184000000001
MDL Number	MFCD20693622
SMILES	Nc1ccc2c(c1)ccc(c2)C(=O)C

1-(6-Aminonaphthalen-2-yl)ethanone, also known as $name$, is a versatile compound commonly used in chemical synthesis. This compound plays a crucial role in the production of various pharmaceuticals, agrochemicals, and fine chemicals due to its unique chemical properties.In chemical synthesis, $name$ is primarily employed as a building block for the construction of complex organic molecules. Its structure allows for efficient derivatization and modification, making it a valuable intermediate in the synthesis of biologically active compounds. By incorporating 1-(6-Aminonaphthalen-2-yl)ethanone into synthetic pathways, chemists can access a wide range of functionalized derivatives with tailored properties.Furthermore, the presence of the amino group in the naphthalene ring confers reactivity and selectivity to the molecule, enabling precise control over regioselective and stereoselective reactions. This feature makes $name$ particularly useful in the creation of chiral compounds and heterocyclic structures, which are essential components in drug discovery and material science.Overall, the application of 1-(6-Aminonaphthalen-2-yl)ethanone in chemical synthesis showcases its significance as a key building block in the development of novel molecules with diverse functionalities and applications.