
Catalog Number	AR00FHPW
Chemical Name	5-Thiazolecarboxylic acid, 2-[[(1,1-dimethylethoxy)carbonyl]amino]-, methyl ester
CAS Number	745078-03-9
Molecular Formula	C10H14N2O4S
Molecular Weight	258.2942
MDL Number	MFCD11655929
SMILES	COC(=O)c1cnc(s1)NC(=O)OC(C)(C)C

Methyl 2-((tert-butoxycarbonyl)amino)thiazole-5-carboxylate is a versatile compound widely used in chemical synthesis due to its unique properties and reactivity. This compound serves as a valuable building block in the synthesis of various complex organic molecules. Specifically, it is commonly employed as a protecting group for amines in organic synthesis.The tert-butoxycarbonyl (Boc) protecting group is commonly used in organic chemistry to temporarily mask the amino group of an amine. By incorporating the Boc group into the structure of the thiazole-5-carboxylate compound, it allows for selective manipulation of the amine functionality during synthesis. This protection strategy is crucial in multistep organic synthesis to prevent undesired side reactions or to control the reactivity of specific functional groups.Furthermore, the thiazole ring in Methyl 2-((tert-butoxycarbonyl)amino)thiazole-5-carboxylate imparts additional functionality and reactivity to the molecule, making it a valuable intermediate in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals. Its structural features allow for versatile chemical transformations, making it a valuable tool for synthetic chemists looking to access diverse chemical space.Overall, the application of Methyl 2-((tert-butoxycarbonyl)amino)thiazole-5-carboxylate in chemical synthesis highlights its importance as a key building block for the construction of complex organic molecules with tailored properties and functionalities.