
Catalog Number	AR00ID7X
Chemical Name	ETHYL 2,4-DIBROMO-1H-IMIDAZOLE-5-CARBOXYLATE
CAS Number	74478-96-9
Molecular Formula	C6H6Br2N2O2
Molecular Weight	297.9320399999999
MDL Number	MFCD29059195
SMILES	CCOC(=O)c1c(Br)nc([nH]1)Br

Ethyl 2,4-dibromo-1H-imidazole-5-carboxylate is a versatile compound commonly used in chemical synthesis for its unique reactivity and functionality. In organic synthesis, this compound serves as a valuable building block for the preparation of various heterocyclic compounds. It can undergo different types of reactions, such as nucleophilic substitution, condensation, and cyclization reactions, to form complex molecules with diverse properties. Additionally, Ethyl 2,4-dibromo-1H-imidazole-5-carboxylate is often employed in the development of pharmaceuticals, agrochemicals, and materials due to its potential to introduce specific functional groups and structural motifs into target molecules. Its ability to participate in multiple synthetic pathways makes it a valuable tool for chemists seeking to design and construct novel compounds with tailored properties and applications.