
Catalog Number	AR00FIEH
Chemical Name	Tetrabutylammonium hydroxide hydrate
CAS Number	74296-38-1
Molecular Formula	C16H39NO2
Molecular Weight	277.4864
MDL Number	MFCD00149573
SMILES	CCCC[N+](CCCC)(CCCC)CCCC.O.[OH-]

Tetrabutylammonium hydroxide hydrate is a versatile and powerful reagent commonly used in chemical synthesis. As a strong base, it plays a crucial role in various reactions by facilitating deprotonation and promoting the formation of new chemical bonds. In organic synthesis, it is frequently employed in the preparation of amines, ethers, and esters through processes such as deprotonation, nucleophilic substitution, and elimination reactions. Additionally, Tetrabutylammonium hydroxide hydrate is utilized in the production of pharmaceuticals, agrochemicals, and specialty chemicals due to its high reactivity and selectivity in promoting specific transformations. Its ability to efficiently catalyze reactions and enable the synthesis of complex molecules makes it an indispensable tool for chemists in both academia and industry.