
Catalog Number	AR00J8FC
Chemical Name	2-Amino-3-methylnaphthalene-1,4-dione
CAS Number	7427-09-0
Molecular Formula	C11H9NO2
Molecular Weight	187.1947
MDL Number	MFCD00667088
SMILES	CC1=C(N)C(=O)c2c(C1=O)cccc2

The versatile compound 2-Amino-3-methylnaphthalene-1,4-dione plays a crucial role in chemical synthesis as a key intermediate in the production of various organic molecules. Its unique structure and reactivity make it an essential building block for the synthesis of complex pharmaceuticals, dyes, and agrochemicals. By serving as a starting material or a reactive intermediate, this compound enables chemists to efficiently and selectively construct a wide range of structurally diverse compounds through various synthetic pathways. Whether used in the creation of novel drug candidates or the development of advanced materials, 2-Amino-3-methylnaphthalene-1,4-dione offers chemists a valuable tool for achieving their synthetic goals with precision and efficiency.