
Catalog Number	AR00FB1D
Chemical Name	L-Leucine beta-naphthylamide
CAS Number	732-85-4
Molecular Formula	C16H20N2O
Molecular Weight	256.3428
MDL Number	MFCD00055914
SMILES	CC(C[C@@H](C(=O)Nc1ccc2c(c1)cccc2)N)C

Leucine-β-naphthylamide, also known as Leu-β-naphthylamide, is a valuable compound widely used in chemical synthesis applications. This compound serves as a versatile substrate in enzymatic assays to detect the presence and activity of specific proteolytic enzymes, particularly those with a preference for cleaving peptide bonds adjacent to leucine residues. Leu-β-naphthylamide is specifically designed to release a colored or fluorescent product upon enzymatic cleavage, allowing for easy and rapid detection and measurement of protease activity in biological samples. In addition to its use in enzymatic assays, Leu-β-naphthylamide also finds applications in the development and optimization of pharmaceuticals, where its ability to mimic specific cleavage sites aids in the design of targeted drug molecules. This versatile compound plays a crucial role in advancing chemical synthesis techniques and in the study of proteolytic enzymes, making it an indispensable tool for researchers and professionals in the field of biochemistry and pharmaceutical sciences.