
Catalog Number	AR008RIH
Chemical Name	Borane,tris(2,4,6-trimethylphenyl)-
CAS Number	7297-95-2
Molecular Formula	C27H33B
Molecular Weight	368.3619
MDL Number	MFCD00008539
SMILES	Cc1cc(C)cc(c1B(c1c(C)cc(cc1C)C)c1c(C)cc(cc1C)C)C

Borane, tris(2,4,6-trimethylphenyl)- is a powerful and versatile reagent widely used in chemical synthesis due to its unique properties. This compound, also known as TTM borane, serves as an efficient reducing agent and a mild Lewis acid in various organic transformations. In the field of organic synthesis, TTM borane plays a crucial role in reducing functional groups such as aldehydes, ketones, and imines to their respective alcohols with high selectivity and efficiency. Additionally, TTM borane is employed in the selective reduction of double bonds and the deoxygenation of sulfoxides and sulfones. Its exceptional performance in asymmetric reductions makes it a valuable tool in the synthesis of pharmaceuticals, agrochemicals, and fine chemicals. Furthermore, TTM borane is utilized in the preparation of complex molecules and in the modification of natural products, demonstrating its significance in the realm of chemical synthesis.