
Catalog Number	AR00FALQ
Chemical Name	Isopentyl-4-Methoxycinnamate
CAS Number	71617-10-2
Molecular Formula	C15H20O3
Molecular Weight	248.3175
MDL Number	MFCD00583856
SMILES	COc1ccc(cc1)C=CC(=O)OCCC(C)C
NSC Number	408332

Isopentyl 3-(4-methoxyphenyl)acrylate is a versatile compound commonly used in chemical synthesis. With its unique molecular structure, this compound serves as a valuable building block in the creation of various organic compounds. In chemical synthesis, Isopentyl 3-(4-methoxyphenyl)acrylate can be utilized as a key intermediate in the development of pharmaceuticals, agrochemicals, and specialty chemicals. Its reactive acrylate group allows for easy functionalization, making it an ideal starting material for the synthesis of complex molecules. Additionally, the presence of the 4-methoxyphenyl moiety imparts specific properties to the final products, making it a valuable component in the design of novel materials. The application of Isopentyl 3-(4-methoxyphenyl)acrylate in chemical synthesis showcases its importance in advancing the field of organic chemistry and its significant role in the creation of innovative compounds.