
Catalog Number	AR003OY3
Chemical Name	BIS(3,5-DIMETHYLPHENYL)PHOSPHINE
CAS Number	71360-06-0
Molecular Formula	C16H19P
Molecular Weight	242.2958
MDL Number	MFCD01074629
SMILES	Cc1cc(Pc2cc(C)cc(c2)C)cc(c1)C

Bis(3,5-dimethylphenyl)phosphine, also known as $name$, is a versatile organophosphorus compound commonly used in chemical synthesis as a ligand in transition metal-catalyzed reactions. Its unique structure allows it to act as a Lewis base, coordinating with metal centers to facilitate various transformations.$name$ is particularly valued in the field of homogeneous catalysis, where it plays a crucial role in promoting key bond-forming processes. In palladium-catalyzed coupling reactions, such as Suzuki-Miyaura and Heck reactions, $name$ can enhance the efficiency and selectivity of the catalytic system. Additionally, $name$ has been employed in cross-coupling reactions, carbon-carbon bond formations, and hydrogenation reactions, among others.Furthermore, the steric and electronic properties of $name$ make it an attractive option for controlling the reactivity and stability of the catalyst, leading to improved performance and higher yields in complex chemical transformations. Its use is not limited to any specific type of reaction, showcasing its versatility and importance in modern synthetic chemistry.