
Catalog Number	AR00ICUB
Chemical Name	1,1-Ethenediamine,N-[2-[[[5-[(dimethylamino)methyl]-2-furanyl]methyl]thio]ethyl]-N'-methyl-2-nitro-, hydrochloride
CAS Number	71130-06-8
Molecular Formula	C13H23ClN4O3S
Molecular Weight	350.8647
MDL Number	MFCD00081180
SMILES	CN/C(=C/[N+](=O)[O-])/NCCSCc1ccc(o1)CN(C)C.Cl

1,1-Ethenediamine, N-[2-[[[5-[(dimethylamino)methyl]-2-furanyl]methyl]thio]ethyl]-N′-methyl-2-nitro-, hydrochloride (1:?) is a versatile compound that finds valuable applications in chemical synthesis. This unique compound serves as a key building block in the synthesis of complex organic molecules due to its ability to participate in a variety of chemical reactions. Its functional groups allow for the introduction of specific substituents and modifications, making it a valuable tool in the creation of novel compounds.In chemical synthesis, 1,1-Ethenediamine, N-[2-[[[5-[(dimethylamino)methyl]-2-furanyl]methyl]thio]ethyl]-N′-methyl-2-nitro-, hydrochloride (1:?) can be used as a key intermediate for the synthesis of pharmaceuticals, agrochemicals, and various specialty chemicals. Its unique structure and reactivity make it an essential component in the construction of diverse molecular architectures with specific desired properties.Researchers and chemists rely on the versatility of this compound to efficiently access a wide range of structurally complex molecules with diverse applications in the field of chemistry.