
Catalog Number	AR0062L2
Chemical Name	(2,2-Dimethyl-1,3-dioxolan-4-yl)methyl methacrylate
CAS Number	7098-80-8
Molecular Formula	C10H16O4
Molecular Weight	200.2316
MDL Number	MFCD21334174
SMILES	CC(=C)C(=O)OCC1COC(O1)(C)C

(2,2-Dimethyl-1,3-dioxolan-4-yl)methyl 2-methyl-2-propenoate, also known as $name$, is a versatile compound widely used in chemical synthesis. Its unique structure and properties make it a valuable reagent in various reactions and processes.In chemical synthesis, (2,2-Dimethyl-1,3-dioxolan-4-yl)methyl 2-methyl-2-propenoate serves as a key building block for the preparation of various organic compounds. It can participate in reactions such as esterifications, acylations, and olefin metathesis, leading to the formation of new carbon-carbon and carbon-oxygen bonds.Additionally, the presence of the dioxolane ring in (2,2-Dimethyl-1,3-dioxolan-4-yl)methyl 2-methyl-2-propenoate imparts stability and rigidity to the molecule, making it an ideal precursor for the synthesis of complex molecules and chiral compounds. Its ability to act as a protecting group for aldehydes and ketones further expands its utility in organic transformations.Overall, the application of (2,2-Dimethyl-1,3-dioxolan-4-yl)methyl 2-methyl-2-propenoate in chemical synthesis underscores its significance in enabling the efficient and selective construction of intricate molecular structures with diverse functionalities.