
Catalog Number	AR019FMC
Chemical Name	2-amino-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide
CAS Number	70733-09-4
Molecular Formula	C10H14N2OS
Molecular Weight	210.296
MDL Number	MFCD05023240
SMILES	CC1CCc2c(C1)c(C(=O)N)c(s2)N

2-Amino-4,5,6,7-tetrahydro-5-methylbenzo[b]thiophene-3-carboxamide, also known as $name$, is a versatile compound commonly used in chemical synthesis. As a key building block in organic chemistry, this compound serves as a valuable intermediate in the synthesis of various pharmaceuticals, agrochemicals, and fine chemicals. Its unique structure and reactivity make it an essential component in the production of diverse chemical compounds with high efficiency and precision. In chemical synthesis, $name$ plays a crucial role in forming complex molecular structures and functional groups, enabling the creation of novel compounds with tailored properties and applications across different industries.