
Catalog Number	AR003AC9
Chemical Name	Carbamic acid, N-[(1R,3aR,4aR,6R,8aR,9S,9aS)-9-[(1E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]dodecahydro-1-methyl-3-oxonaphtho[2,3-c]furan-6-yl]-, ethyl ester, sulfate (1:1)
CAS Number	705260-08-8
Molecular Formula	C29H35FN2O8S
Molecular Weight	590.6602
MDL Number	MFCD16038877
SMILES	OS(=O)(=O)O.CCOC(=O)N[C@@H]1CC[C@@H]2[C@@H](C1)C[C@@H]1[C@H]([C@H]2/C=C/c2ccc(cn2)c2cccc(c2)F)[C@H](OC1=O)C

In chemical synthesis, Carbamic acid, N-[(1R,3aR,4aR,6R,8aR,9S,9aS)-9-[(1E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]dodecahydro-1-methyl-3-oxonaphtho[2,3-c]furan-6-yl]-, ethyl ester, sulfate (1:1) can serve as a key intermediate for the production of various pharmaceutical compounds. Its unique structure and reactivity make it a versatile building block in the synthesis of complex molecules, allowing for the modification of functional groups and stereochemistry to tailor the properties of the final products. The presence of the carbamate group enables selective transformations through cleavage or modification, while the sulfate moiety can act as a protecting group or facilitate coupling reactions with other compounds. By strategically incorporating this compound into synthetic pathways, chemists can access diverse chemical space and unlock new possibilities for drug discovery and material science applications.