
Catalog Number	AR01FGUO
Chemical Name	Benzoic acid,3,3',3'',3'''-(21H,23H-porphine-5,10,15,20-tetrayl)tetrakis-
CAS Number	70152-54-4
Molecular Formula	C48H30N4O8
Molecular Weight	790.7738
MDL Number	MFCD22377424
SMILES	OC(=O)c1cccc(c1)C1=C2C=CC(=N2)C(=c2ccc(=C(C3=NC(=C(c4[nH]c1cc4)c1cccc(c1)C(=O)O)C=C3)c1cccc(c1)C(=O)O)[nH]2)c1cccc(c1)C(=O)O

3,3′,3′′,3′′′-(21H,23H-Porphine-5,10,15,20-tetrayl)tetrakis[benzoic acid] is a versatile compound widely utilized in chemical synthesis. This potent molecule serves as a valuable building block in the design and creation of novel organic frameworks. Its unique structure, characterized by a central porphyrin core and four benzoic acid groups, imparts distinctive chemical properties that make it a valuable tool in various synthetic pathways.In chemical synthesis, 3,3′,3′′,3′′′-(21H,23H-Porphine-5,10,15,20-tetrayl)tetrakis[benzoic acid] is employed as a key reagent for constructing complex molecular architectures. The benzoic acid groups attached to the porphyrin core enable precise functionalization, facilitating the formation of custom-designed molecular structures with specific properties. This compound's ability to selectively bind with other molecules enables the controlled assembly of intricate chemical entities, making it ideal for the creation of advanced materials and compounds with tailored functionalities.Furthermore, the porphyrin core of 3,3′,3′′,3′′′-(21H,23H-Porphine-5,10,15,20-tetrayl)tetrakis[benzoic acid] offers a platform for catalytic applications in chemical transformations. By leveraging the unique electronic properties of the porphyrin system, this compound can function as a catalyst in various organic reactions, accelerating the conversion of substrates into desired products with high efficiency and selectivity.Overall, the strategic incorporation of 3,3′,3′′,3′′′-(21H,23H-Porphine-5,10,15,20-tetrayl)tetrakis[benzoic acid] in chemical synthesis enables the development of innovative synthetic routes and the construction of complex molecular architectures with tailored functionalities and catalytic capabilities.