
Catalog Number	AR00FE57
Chemical Name	PETUNIDIN 3-GLUCOSIDE
CAS Number	6988-81-4
Molecular Formula	C22H23ClO12
Molecular Weight	514.8638
MDL Number	MFCD01762898
SMILES	OC[C@H]1O[C@@H](Oc2cc3c(O)cc(cc3[o+]c2c2cc(O)c(c(c2)OC)O)O)[C@@H]([C@H]([C@@H]1O)O)O.[Cl-]

Petunidin 3-glucoside, also known as Petunidin-3-O-glucoside, is a naturally occurring compound belonging to the class of anthocyanins. This molecule serves as a valuable reagent in chemical synthesis due to its unique properties and versatile applications. In organic chemistry, Petunidin 3-glucoside is widely utilized as a precursor for the synthesis of various organic compounds and complex molecules. Its ability to undergo regioselective modifications makes it a valuable building block in the development of novel pharmaceuticals, agrochemicals, and functional materials. Furthermore, the presence of a glucoside group enhances the solubility and stability of the compound, making it an ideal choice for various synthetic transformations and reactions. Overall, Petunidin 3-glucoside plays a crucial role in advancing the field of chemical synthesis by enabling the creation of innovative and diverse chemical structures.