
Catalog Number	AR003H4V
Chemical Name	2-Amino-4-oxo-4,7-dihydro-3H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile
CAS Number	69205-79-4
Molecular Formula	C7H5N5O
Molecular Weight	175.1475
MDL Number	MFCD13178502
SMILES	N#Cc1c[nH]c2c1c(=O)[nH]c(n2)N

2-Amino-4-oxo-4,7-dihydro-3H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile is a versatile compound that finds extensive application in chemical synthesis. Its reactive nature allows it to participate in a variety of reactions, leading to the formation of diverse organic compounds. This compound serves as a key building block in the creation of pharmaceuticals, agrochemicals, and materials with complex structures. Its carbonitrile group enables the introduction of additional chemical functionalities, making it a valuable component in the synthesis of novel organic molecules with tailored properties. Furthermore, its unique heterocyclic structure imparts distinct characteristics to the final products, enhancing their potential applications in various industries.