
Catalog Number	AR00FBXA
Chemical Name	(+)-Trans-limonene 1,2-epoxide
CAS Number	6909-30-4
Molecular Formula	C10H16O
Molecular Weight	152.2334
MDL Number	MFCD16652609
SMILES	CC(=C)[C@@H]1CC[C@]2([C@@H](C1)O2)C

(+)-trans-Limonene oxide is a versatile compound commonly utilized in chemical synthesis for various applications. This natural product is renowned for its unique chemical structure and reactivity, making it a valuable building block in the creation of numerous compounds. In organic chemistry, (+)-trans-Limonene oxide serves as a valuable chiral starting material due to its inherent asymmetry, enabling the synthesis of enantiomerically pure compounds. Its cyclic structure and functional groups make it particularly useful in the formation of complex molecules, such as pharmaceutical intermediates, fragrances, and flavorings. Additionally, (+)-trans-Limonene oxide can be utilized as a precursor in the synthesis of polymers, surfactants, and agricultural chemicals, showcasing its widespread utility across various industries. Its ability to undergo diverse chemical transformations highlights its importance as a key reagent in the realm of chemical synthesis, enabling the efficient creation of a wide array of compounds with specific structural and functional properties.