
Catalog Number	AR01DQNQ
Chemical Name	2-Naphthalenecarboxylic acid, 4,4'-methylenebis[3-hydroxy-, compd.with 3-[(1E)-2-(1,4,5,6-tetrahydro-1-methyl-2-pyrimidinyl)ethenyl]phenol(1:1)OTHER CA INDEX NAMES:Phenol, 3-[(1E)-2-(1,4,5,6-tetrahydro-1-methyl-2-pyrimidinyl)ethenyl]-,4,4'-methylenebis[3-hydroxy-2-naphthalenecarboxylate] (1:1) (salt)
CAS Number	68813-55-8
Molecular Formula	C36H32N2O7
Molecular Weight	604.6485
MDL Number	MFCD19105662
SMILES	OC(=O)c1cc2ccccc2c(c1O)Cc1c(O)c(cc2c1cccc2)C(=O)O.Oc1cccc(c1)/C=C/C1=NCCCN1C
NSC Number	759296

Oxantel pamoate is a valuable compound used in chemical synthesis for its application as an anthelmintic agent. In organic chemistry, it serves as a key building block in the synthesis of various pharmaceuticals and agrochemicals. Its unique chemical properties make it a versatile reagent in the creation of novel molecules with potential therapeutic benefits. By incorporating Oxantel pamoate into synthetic pathways, chemists can access new compounds that exhibit anthelmintic activity, thereby contributing to the development of effective treatments against parasitic infections. With its role in chemical synthesis, Oxantel pamoate plays a crucial part in advancing pharmaceutical research and improving global healthcare.