
Catalog Number	AR00FC5L
Chemical Name	5-METHYLTETRAHYDROFOLIC ACID DISODIUM SALT
CAS Number	68792-52-9
Molecular Formula	C20H23N7Na2O6
Molecular Weight	503.4195
MDL Number	MFCD28385585
SMILES	[O-]C(=O)CCC(C(=O)[O-])NC(=O)c1ccc(cc1)NCC1CNc2c(N1C)c(=O)[nH]c(n2)N.[Na+].[Na+]

Sodium 2-(4-(((2-amino-5-methyl-4-oxo-3,4,5,6,7,8-hexahydropteridin-6-yl)methyl)amino)benzamido)pentanedioate is a versatile compound widely utilized in chemical synthesis for its unique properties. It serves as a key reagent in the preparation of complex organic molecules due to its ability to act as a nucleophile, facilitating various bond-forming reactions.In chemical synthesis, Sodium 2-(4-(((2-amino-5-methyl-4-oxo-3,4,5,6,7,8-hexahydropteridin-6-yl)methyl)amino)benzamido)pentanedioate is particularly valuable in peptide coupling reactions, where it acts as a coupling agent to link amino acids together. This compound's structure enables it to efficiently form amide bonds, a crucial step in the synthesis of peptides and proteins.Furthermore, Sodium 2-(4-(((2-amino-5-methyl-4-oxo-3,4,5,6,7,8-hexahydropteridin-6-yl)methyl)amino)benzamido)pentanedioate plays a key role in the synthesis of pharmaceuticals, agrochemicals, and other biologically active compounds. Its utility in chemical synthesis extends to the production of diverse materials, making it an indispensable tool for organic chemists striving to create new molecules with tailored properties and functions.