
Catalog Number	AR00FGT3
Chemical Name	((1r,4r)-4-((tert-butoxycarbonyl)amino)cyclohexyl)methyl methanesulfonate
CAS Number	683269-95-6
Molecular Formula	C13H25NO5S
Molecular Weight	307.4063
MDL Number	MFCD28383641
SMILES	COS(=O)(=O)C[C@@H]1CC[C@H](CC1)NC(=O)OC(C)(C)C

The compound $name$ is utilized as a versatile reagent in the field of chemical synthesis. 
This specialized molecule, trans-4-((tert-butoxycarbonyl)amino)cyclohexyl)methyl methanesulfonate, is a key component for protecting amine functionalities during organic transformations. The tert-butoxycarbonyl (Boc) group serves as a shielding agent for the amino group, allowing selective reactions to occur with other functional groups present in the molecule. This protection strategy is crucial in ensuring the desired regioselectivity and reactivity in complex organic synthesis processes. By utilizing $name$, chemists can efficiently manipulate and control the chemical reactions, facilitating the creation of new compounds with specific structures and properties.