
Catalog Number	AR00FEO6
Chemical Name	(E)-m-(trifluoromethyl)cinnamic acid
CAS Number	67801-07-4
Molecular Formula	C10H7F3O2
Molecular Weight	216.1566
MDL Number	MFCD00004393
SMILES	OC(=O)/C=C/c1cccc(c1)C(F)(F)F

(2E)-3-[3-(Trifluoromethyl)phenyl]-2-propenoic acid, also known as $name$, is a versatile compound widely used in chemical synthesis as a key intermediate for the preparation of various organic compounds. In chemical synthesis, $name$ serves as a valuable building block due to its unique chemical properties and structural features.One important application of (2E)-3-[3-(Trifluoromethyl)phenyl]-2-propenoic acid is in the synthesis of pharmaceuticals and agrochemicals. Its trifluoromethyl group plays a crucial role in enhancing the biological activity and metabolic stability of the final products. By incorporating (2E)-3-[3-(Trifluoromethyl)phenyl]-2-propenoic acid into the molecular structure of target compounds, chemists can modulate the pharmacokinetic properties and optimize the efficacy of the synthesized molecules.Additionally, (2E)-3-[3-(Trifluoromethyl)phenyl]-2-propenoic acid is utilized in the synthesis of specialty chemicals, such as fluorinated building blocks and materials. The presence of the trifluoromethyl substituent imparts unique physicochemical properties to the synthesized compounds, making them valuable in various industrial applications, including material science and chemical engineering.Overall, (2E)-3-[3-(Trifluoromethyl)phenyl]-2-propenoic acid offers a wide range of possibilities in chemical synthesis, enabling the creation of innovative compounds with tailored properties and functionalities. Its versatility and importance make it a valuable tool for chemists and researchers across different fields of chemistry.