
Catalog Number	AR00FCMQ
Chemical Name	(R)-2-(methoxycarbonylamino)-3-phenylpropanoic acid
CAS Number	67401-65-4
Molecular Formula	C11H13NO4
Molecular Weight	223.22522
MDL Number	MFCD15529910
SMILES	COC(=O)N[C@@H](C(=O)O)Cc1ccccc1

The (R)-2-(Methoxycarbonylamino)-3-phenylpropanoic acid, also known as $name$, plays a crucial role in chemical synthesis as a versatile building block. This compound is commonly utilized as a chiral starting material in the preparation of various pharmaceuticals and agrochemicals. Its unique structure enables it to serve as a key intermediate in the synthesis of complex organic molecules.In chemical synthesis, (R)-2-(Methoxycarbonylamino)-3-phenylpropanoic acid serves as a valuable precursor for the introduction of a chiral center into target molecules. By incorporating this compound into a synthetic pathway, chemists can efficiently access enantiomerically pure compounds, which are essential in many pharmaceutical and medicinal applications. The presence of both an amino and carboxylic acid functional group in $name$ allows for diverse chemical transformations, making it a versatile tool in the hands of synthetic chemists. Furthermore, the phenyl group attached to the propionic acid backbone offers additional opportunities for further functionalization and modification.Overall, (R)-2-(Methoxycarbonylamino)-3-phenylpropanoic acid is a valuable reagent in chemical synthesis due to its chirality, functional groups, and structural flexibility. Its applications extend beyond the laboratory and into the production of numerous biologically active compounds, making it a fundamental component in the toolkit of organic chemists.