
Catalog Number	AR00FATZ
Chemical Name	(R,R)-Formoterol
CAS Number	67346-49-0
Molecular Formula	C19H24N2O4
Molecular Weight	344.4049
MDL Number	MFCD00864141
SMILES	O=CNc1cc(ccc1O)[C@H](CN[C@@H](Cc1ccc(cc1)OC)C)O

The compound N-[2-Hydroxy-5-[(1R)-1-hydroxy-2-[[(1R)-2-(4-methoxyphenyl)-1-methylethyl]amino]ethyl]phenyl]formamide is an important reagent in chemical synthesis processes due to its ability to serve as a versatile building block in the creation of complex molecules. This compound is particularly valuable in the field of medicinal chemistry and drug development, where it can be utilized as a key intermediate in the synthesis of pharmaceutical compounds with potential therapeutic applications. Its unique structure and functional groups enable it to participate in a variety of reactions, allowing chemists to efficiently access a wide range of novel compounds for further study and potential use in drug discovery. Through its strategic incorporation into synthetic pathways, N-[2-Hydroxy-5-[(1R)-1-hydroxy-2-[[(1R)-2-(4-methoxyphenyl)-1-methylethyl]amino]ethyl]phenyl]formamide plays a crucial role in advancing the synthesis of new chemical entities with enhanced biological activities and pharmacological properties.