
Catalog Number	AR006MOA
Chemical Name	(S)-2-((Methylsulfonyl)oxy)propanoic acid
CAS Number	66423-08-3
Molecular Formula	C4H8O5S
Molecular Weight	168.1683
MDL Number	MFCD26743570
SMILES	OC(=O)[C@@H](OS(=O)(=O)C)C

(S)-2-((Methylsulfonyl)oxy)propanoic acid, also known as MSPA, is a versatile compound widely used in chemical synthesis for its unique properties and application. As a chiral sulfonyloxy-substituted acid, MSPA serves as a key building block in the preparation of various enantiomerically pure compounds. Its stereochemistry plays a crucial role in controlling the stereochemical outcome of reactions, making it indispensable in asymmetric synthesis strategies.MSPA is commonly employed in the synthesis of pharmaceuticals, agrochemicals, and fine chemicals where enantioselectivity is of utmost importance. By serving as a chiral auxiliary or a chiral resolving agent, MSPA enables the creation of molecules with high stereochemical purity, critical for the efficacy and safety of bioactive compounds. Additionally, MSPA can be utilized in the formation of chiral catalysts, ligands, and intermediates in organic synthesis, further expanding its synthetic utility.Moreover, the presence of the methylsulfonyl group in MSPA offers unique reactivity patterns, allowing for the facile transformation of the compound into a variety of functionalized derivatives. This versatility enables chemists to access a diverse array of structurally complex molecules through strategic derivatization of MSPA, enhancing the synthetic efficiency and scope of organic transformations.