
Catalog Number	AR00FQ37
Chemical Name	Dimethyl-2-benzylidenemalonate
CAS Number	6626-84-2
Molecular Formula	C12H12O4
Molecular Weight	220.22128000000004
MDL Number	MFCD00087288
SMILES	COC(=O)C(=Cc1ccccc1)C(=O)OC
NSC Number	58321

Dimethyl benzylidenemalonate, also known as DBM, is a versatile compound commonly used in chemical synthesis for its unique reactivity and ability to participate in various reactions. In organic chemistry, DBM is often employed as a Michael acceptor, meaning it can undergo conjugate addition reactions with nucleophiles to form highly functionalized compounds. This reactivity makes DBM a valuable building block for the synthesis of complex organic molecules. Furthermore, DBM can also act as a ligand in transition metal-catalyzed reactions, facilitating selective bond formation and enabling the synthesis of chiral compounds. Due to its diverse applications in chemical synthesis, dimethyl benzylidenemalonate is a valuable tool for researchers and synthetic chemists seeking to access novel molecules and explore new reaction pathways.