
Catalog Number	AR019FP4
Chemical Name	2-((4R)-4-((3R,5R,6S,7R,10R,13R)-3,6,7-Trihydroxy-10,13-Dimethylhexadecahydro-1H-Cyclopenta[A]Phenanthren-17-Yl)Pentanamido)Acetic Acid
CAS Number	66225-78-3
Molecular Formula	C26H43NO6
Molecular Weight	465.6227
MDL Number	MFCD31579960
SMILES	O[C@@H]1CC[C@]2([C@@H](C1)[C@H](O)[C@@H](C1C2CC[C@]2(C1CCC2[C@@H](CCC(=O)NCC(=O)O)C)C)O)C

2-((4R)-4-((3R,5R,6S,7R,10R,13R)-3,6,7-Trihydroxy-10,13-Dimethylhexadecahydro-1H-Cyclopenta[A]Phenanthren-17-Yl)Pentanamido)Acetic Acid, commonly known as $name$, is a versatile compound widely used in chemical synthesis for its unique properties and structural characteristics.In chemical synthesis, $name$ serves as a valuable building block due to its functional groups and stereochemistry, allowing for the creation of complex molecular structures. Its pentanamidoacetic acid moiety provides a stable linkage for the attachment of various substituents, facilitating the synthesis of peptide analogs and bioconjugates.Furthermore, the cyclopenta[a]phenanthrene core of $name$ offers a rigid framework that can be utilized in the construction of novel scaffolds for drug discovery and development. The presence of multiple hydroxy groups on the cyclopenta[a]phenanthrene ring provides opportunities for further derivatization and modification, enabling the synthesis of diverse chemical entities with potential biological activities.Overall, the application of 2-((4R)-4-((3R,5R,6S,7R,10R,13R)-3,6,7-Trihydroxy-10,13-Dimethylhexadecahydro-1H-Cyclopenta[A]Phenanthren-17-Yl)Pentanamido)Acetic Acid in chemical synthesis opens up avenues for the creation of structurally intricate molecules with tailored functionalities, making it a valuable asset in the realm of organic chemistry and drug design.