
Catalog Number	AR003KO6
Chemical Name	4-(2-BROMOETHYL)BENZENESULFONIC ACID SODIUM SALT
CAS Number	65036-65-9
Molecular Formula	C8H8BrNaO3S
Molecular Weight	287.1061
MDL Number	MFCD04039870
SMILES	BrCCc1ccc(cc1)S(=O)(=O)[O-].[Na+]

Sodium 4-(2-bromoethyl)benzenesulfonate is a versatile chemical compound widely used in chemical synthesis processes. Its application in organic chemistry involves serving as a key intermediate in the preparation of various organic compounds through nucleophilic substitution reactions. This compound acts as a reactive reagent in the synthesis of pharmaceuticals, agrochemicals, and specialty chemicals. Its unique structure and reactivity make it a valuable building block in the creation of complex organic molecules. Additionally, Sodium 4-(2-bromoethyl)benzenesulfonate plays a crucial role in the development of novel materials and functionalized organic compounds, making it a valuable tool for synthetic chemists in the research and development of new materials and compounds.