
Catalog Number	AR00F81S
Chemical Name	L-CIS-PYRROLIDINE-2,4-DICARBOXYLIC ACID
CAS Number	64927-38-4
Molecular Formula	C6H9NO4
Molecular Weight	159.14
MDL Number	MFCD00274448
SMILES	OC(=O)[C@H]1NC[C@H](C1)C(=O)O

2,4-Pyrrolidinedicarboxylic acid, (2S,4S)- is a crucial chiral building block widely utilized in chemical synthesis. With its unique structure and stereochemistry, this compound serves as a versatile intermediate in the creation of various pharmaceuticals, agrochemicals, and specialty chemicals. In asymmetric synthesis, this compound plays a key role in facilitating the formation of complex molecules with high enantiomeric purity. Its presence enables the precise control of stereochemistry in the synthesis of stereoselective compounds, making it an indispensable tool for chemists working in medicinal chemistry and materials science. Moreover, the use of 2,4-Pyrrolidinedicarboxylic acid, (2S,4S)- in chemical synthesis showcases its significance in driving innovation and enabling the development of advanced functional materials.