
Catalog Number	AR00EE24
Chemical Name	4-(4-Nitrobenzyl)morpholine
CAS Number	6425-46-3
Molecular Formula	C11H14N2O3
Molecular Weight	222.2405
MDL Number	MFCD00448629
SMILES	[O-][N+](=O)c1ccc(cc1)CN1CCOCC1

4-(4-Nitrobenzyl)morpholine is a versatile compound used extensively in chemical synthesis for its unique properties and reactivity. Due to the presence of the nitro functional group and the morpholine ring, this compound serves as a valuable building block in the creation of various organic molecules. In chemical synthesis, 4-(4-Nitrobenzyl)morpholine is commonly employed as a key intermediate in the preparation of pharmaceuticals, agrochemicals, and specialty chemicals. Its ability to undergo diverse transformation reactions such as nucleophilic substitutions, reductions, and oxidations makes it an indispensable tool for synthetic chemists. Moreover, the morpholine moiety in this compound provides steric hindrance and offers enhanced solubility in organic solvents, making it suitable for a wide range of reaction conditions. Additionally, the nitro group can be selectively manipulated to introduce other functional groups into the molecule, further expanding the synthetic possibilities. Overall, 4-(4-Nitrobenzyl)morpholine plays a crucial role in the construction of complex organic molecules and is instrumental in the development of new chemical entities with diverse applications.