
Catalog Number	AR003RN1
Chemical Name	8-Methyl-8-azabicyclo[3.2.1]octan-3-yl 2-hydroxy-2-phenylacetate hydrochloride
CAS Number	637-21-8
Molecular Formula	C16H22ClNO3
Molecular Weight	311.8038
MDL Number	MFCD00050613
SMILES	OC(c1ccccc1)C(=O)OC1CC2CCC(C1)N2C.Cl

Homatropine hydrochloride, a synthetic derivative of atropine, serves as a crucial reagent in various chemical synthesis processes. Its application in organic chemistry is centered around its properties as a chiral catalyst. In asymmetric synthesis, Homatropine hydrochloride is utilized to induce chirality or control stereoselectivity in reactions, leading to the formation of enantiomerically enriched products. The unique structural features of Homatropine hydrochloride allow for precise control over the stereochemistry of the final compound, making it a valuable tool in the preparation of pharmaceutical intermediates and fine chemicals. Additionally, Homatropine hydrochloride can act as a Lewis acid catalyst in certain transformations, facilitating key bond-forming reactions through activation of substrates. Its versatile role in chemical synthesis makes Homatropine hydrochloride a versatile and essential component in the toolkit of synthetic chemists.