
Catalog Number	AR00EJPB
Chemical Name	3-(4-acetamidophenyl)propanoic acid
CAS Number	6325-43-5
Molecular Formula	C11H13NO3
Molecular Weight	207.2258
MDL Number	MFCD07620119
SMILES	OC(=O)CCc1ccc(cc1)NC(=O)C

Benzenepropanoic acid, 4-(acetylamino)- is a versatile compound widely utilized in chemical synthesis. Its primary application lies in organic chemistry, particularly in the modification of various molecules for medicinal and pharmaceutical purposes. This compound is frequently employed as a building block in the synthesis of pharmaceutical agents due to its ability to introduce specific functional groups into organic molecules.In chemical synthesis, Benzenepropanoic acid, 4-(acetylamino)- serves as a key intermediate in the preparation of diverse compounds, including analgesics, anti-inflammatory drugs, and antibiotics. By incorporating this compound into the molecular structure, chemists can enhance the bioavailability, solubility, and overall efficacy of the final product. Additionally, the presence of the acetylamino group provides opportunities for further derivatization, allowing for the customization of molecules to meet specific requirements in drug design.Overall, Benzenepropanoic acid, 4-(acetylamino)- plays a crucial role in the synthesis of pharmaceuticals and biologically active compounds, showcasing its importance in the field of organic chemistry and drug development.