
Catalog Number	AR01B40P
Chemical Name	4-Chloro-3-(chlorosulfonyl)benzoyl chloride
CAS Number	62574-66-7
Molecular Formula	C7H3Cl3O3S
Molecular Weight	273.5209
MDL Number	MFCD21090929
SMILES	ClC(=O)c1ccc(c(c1)S(=O)(=O)Cl)Cl

The benzoyl chloride, 4-chloro-3-(chlorosulfonyl)- is a powerful reagent commonly used in chemical synthesis for a variety of applications. Its unique chemical properties make it a versatile tool in the organic synthesis field. Benzoyl chloride, 4-chloro-3-(chlorosulfonyl)- is frequently employed as an acylating agent in reactions to introduce benzoyl groups into various organic compounds. It is also utilized in the synthesis of pharmaceuticals, agrochemicals, and other specialty chemicals. Additionally, this compound serves as a key building block for the preparation of advanced materials due to its ability to functionalize molecules with both chlorine and sulfonyl groups.