
Catalog Number	AR00EAKZ
Chemical Name	DSIP
CAS Number	62568-57-4
Molecular Formula	C35H48N10O15
Molecular Weight	848.8136200000006
MDL Number	MFCD00076883
SMILES	OC[C@@H](C(=O)NCC(=O)N[C@H](C(=O)O)CCC(=O)O)NC(=O)[C@@H](NC(=O)[C@H](CC(=O)O)NC(=O)CNC(=O)CNC(=O)[C@@H](NC(=O)[C@H](Cc1c[nH]c2c1cccc2)N)C)C

DSIP, or Delta Sleep Inducing Peptide, is a versatile peptide with significant applications in chemical synthesis. In the field of organic chemistry, DSIP is commonly utilized as a catalyst in various reactions to promote efficient and selective transformations. Its ability to facilitate specific bond formations and control reaction pathways make it a valuable tool for synthesizing complex molecules with high yields and purity. Researchers often employ DSIP in the preparation of pharmaceuticals, agrochemicals, and advanced materials due to its efficiency in promoting desired chemical reactions. Additionally, DSIP has shown promise in the development of novel organic transformations and the optimization of reaction conditions, making it a crucial component in modern chemical synthesis strategies.