
Catalog Number	AR003PKQ
Chemical Name	Chorismic acid from Enterobacter aerogenes
CAS Number	617-12-9
Molecular Formula	C10H10O6
Molecular Weight	226.1828
MDL Number	MFCD00135935
SMILES	O[C@@H]1C=CC(=C[C@H]1OC(=C)C(=O)O)C(=O)O

Chorismic acid, a key intermediate in the biosynthesis of aromatic amino acids, plays a crucial role in chemical synthesis by serving as a versatile starting material for the production of various biologically active compounds. Its ability to undergo diverse chemical transformations makes it a valuable building block in the synthesis of pharmaceuticals, agrochemicals, and natural products.In the realm of drug discovery and development, chorismic acid is utilized in the synthesis of antimicrobial agents, antiviral drugs, and anticancer compounds. By incorporating chorismic acid-derived fragments into molecular structures, chemists can design novel molecules with enhanced biological activities and specific pharmacological properties.Furthermore, in the field of materials science, chorismic acid-derived compounds have found applications in the development of new polymers, dyes, and organic materials with tailored properties. Through strategic modifications of the chorismic acid scaffold, researchers can create functional materials with desired characteristics such as conductivity, luminescence, and stability.Overall, the versatility of chorismic acid in chemical synthesis makes it a valuable tool for the creation of diverse compounds with important commercial and scientific applications.