
Catalog Number	AR00EB0F
Chemical Name	(-)-Usnic acid
CAS Number	6159-66-6
Molecular Formula	C18H16O7
Molecular Weight	344.3154
MDL Number	MFCD00017663
SMILES	CC(=O)C1=C(O)[C@]2(C(=CC1=O)Oc1c2c(O)c(C)c(c1C(=O)C)O)C

The compound (9bS)-2,6-Diacetyl-7,9-dihydroxy-8,9b-dimethyl-1,3(2H,9bH)-dibenzofurandione plays a crucial role in chemical synthesis as a versatile building block. Its unique structure allows it to participate in various reactions, making it valuable for the creation of complex organic molecules. One key application of this compound is its ability to undergo acylation reactions, where the acetyl groups can be utilized to introduce new functionalities to the molecule. These acylation reactions are often used to modify the reactivity or selectivity of the compound in subsequent reactions. Additionally, the dihydroxy groups in the molecule can serve as potential sites for further functionalization through processes such as esterification or oxidation. These functional groups can be selectively modified to tailor the properties of the final product.Overall, the (9bS)-2,6-Diacetyl-7,9-dihydroxy-8,9b-dimethyl-1,3(2H,9bH)-dibenzofurandione is a valuable building block in chemical synthesis, offering a range of possibilities for creating diverse organic molecules with specific structures and properties.

Piperidine, 1-methyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-1-yl]-

1323919-64-7

$35.00/100mg, $61.00/250mg, $98.00/500mg, $139.00/1g, $485.00/5g, $866.00/10g, $2,114.00/25g,

Product Details

tert-Butyl 1-oxa-6-azaspiro[2.5]octane-6-carboxylate

147804-30-6

$4.00/1g, $4.00/250mg, $9.00/5g, $18.00/10g, $43.00/25g, $151.00/100g, $753.00/500g,

Product Details

Stannane, tributyl-2-propen-1-yl-

24850-33-7

$3.00/1g, $6.00/5g, $10.00/10g, $14.00/25g, $51.00/100g, $243.00/500g,

Product Details

tert-Butyl 1H-pyrrole-1-carboxylate

5176-27-2

$3.00/1g, $5.00/5g, $6.00/10g, $13.00/25g, $45.00/100g, $208.00/500g, $347.00/1kg,

Product Details

(1-Methyl-1H-pyrazol-4-yl)boronic acid

847818-55-7

$5.00/1g, $19.00/5g, $36.00/10g, $77.00/25g, $305.00/100g, $1,472.00/500g,

Product Details

2-Methylpyridine-4-carboxaldehyde

63875-01-4

$9.00/100mg, $13.00/250mg, $31.00/1g, $64.00/2.5g, $119.00/5g, $238.00/10g, $549.00/25g,

Product Details

(-)-Usnic acid