
Catalog Number	AR00ELDN
Chemical Name	2,3,4,5-tetrafluoro-6-nitrobenzenaMine
CAS Number	6157-98-8
Molecular Formula	C6H2F4N2O2
Molecular Weight	210.0859
MDL Number	MFCD00278791
SMILES	[O-][N+](=O)c1c(N)c(F)c(c(c1F)F)F

2,3,4,5-Tetrafluoro-6-nitroaniline is a versatile compound used in chemical synthesis for its unique properties. This compound is commonly employed as a building block in the pharmaceutical industry for the development of novel drugs. Its tetrafluoro substitution pattern enhances its reactivity and stability, making it a valuable intermediate in organic synthesis. In addition, the nitro group present in the molecule allows for further derivatization, enabling the creation of a wide range of functionalized compounds. Overall, 2,3,4,5-Tetrafluoro-6-nitroaniline plays a crucial role in the creation of advanced molecules with potential applications in various fields of chemistry.