
Catalog Number	AR01F35G
Chemical Name	Oxo-(3-trifluoromethyl-phenyl)-acetic acid
CAS Number	61560-95-0
Molecular Formula	C9H5F3O3
Molecular Weight	218.1294
MDL Number	MFCD07777206
SMILES	OC(=O)C(=O)c1cccc(c1)C(F)(F)F

The α-Oxo-3-(trifluoromethyl)benzeneacetic acid is a versatile compound widely employed in chemical synthesis as a key building block for the generation of various pharmaceuticals, agrochemicals, and advanced materials. Its unique structure, incorporating a trifluoromethyl group and an alpha-keto moiety, imparts valuable properties that are crucial for designing and modifying molecular structures in a controlled manner. In chemical synthesis, this acid serves as a valuable intermediate in complex organic reactions, enabling the introduction of the trifluoromethyl functional group into target molecules efficiently. This compound's reactivity and stability make it a valuable tool for medicinal chemists and material scientists seeking to enhance the bioactivity, metabolic stability, or physicochemical properties of their target compounds. Through strategic manipulation of its chemical properties, α-Oxo-3-(trifluoromethyl)benzeneacetic acid plays a pivotal role in the development of novel compounds with enhanced characteristics and potential applications in various industries.