
Catalog Number	AR00EFFE
Chemical Name	(R)-2,4-Dihydroxy-3,3-dimethylbutyric acid sodium salt
CAS Number	60979-68-2
Molecular Formula	C6H11NaO4
Molecular Weight	170.1389
MDL Number	MFCD29079001
SMILES	OCC([C@H](C(=O)[O-])O)(C)C.[Na+]

Sodium (R)-2,4-dihydroxy-3,3-dimethylbutanoate serves as a versatile chiral building block in chemical synthesis. Its unique stereochemistry and functional groups make it an ideal candidate for use in the development of pharmaceuticals, agrochemicals, and specialty chemicals. As a sodium salt, this compound exhibits enhanced solubility and reactivity, allowing for easier manipulation in synthetic processes. By incorporating sodium (R)-2,4-dihydroxy-3,3-dimethylbutanoate into synthetic pathways, chemists can efficiently access enantiomerically pure compounds with tailored properties and applications.