
Catalog Number	AR00JTJ7
Chemical Name	Ethyl 4-(2-methoxyphenyl)-2,4-dioxobutanoate
CAS Number	60943-39-7
Molecular Formula	C13H14O5
Molecular Weight	250.24726000000004
MDL Number	MFCD08700415
SMILES	CCOC(=O)C(=O)CC(=O)c1ccccc1OC

Ethyl 4-(2-methoxyphenyl)-2,4-dioxobutanoate is a versatile compound frequently used in chemical synthesis as a key building block for the creation of various organic molecules. Its structural arrangement provides unique reactivity that enables the formation of complex structures with diverse functionalities. This compound plays a crucial role in the synthesis of pharmaceuticals, agrochemicals, and fine chemicals due to its ability to participate in a wide range of transformation reactions, including esterification, amidation, and cycloaddition reactions. Additionally, the presence of the methoxyphenyl group enhances the compound's solubility and compatibility with other reagents, making it a valuable tool for designing and constructing advanced molecular architectures.