
Catalog Number	AR01K4T3
Chemical Name	(2R,3S)-2-Amino-3-methylpentanoic acid methyl ester hydrochloride
CAS Number	60667-85-8
Molecular Formula	C7H16ClNO2
Molecular Weight	181.6604
MDL Number	MFCD22207093
SMILES	CC[C@@H]([C@H](C(=O)OC)N)C.Cl

D-Alloisoleucine, methyl ester, hydrochloride (1:1) is a versatile compound that finds extensive application in chemical synthesis processes. This compound serves as a key building block in the creation of peptides, pharmaceuticals, and complex organic molecules. Due to its unique structure and properties, D-Alloisoleucine, methyl ester, hydrochloride (1:1) plays a crucial role in the development of new drugs, agrochemicals, and advanced materials. Its compatibility with a variety of chemical reactions and its ability to introduce specific structural elements make it an indispensable tool for chemists and researchers working in the field of organic synthesis. Whether used as a chiral auxiliary, a protecting group, or a precursor for more complex molecules, D-Alloisoleucine, methyl ester, hydrochloride (1:1) offers a wide range of possibilities for designing and optimizing chemical processes. By incorporating this compound into their synthetic strategies, chemists can access a diverse array of molecular architectures with tailored properties and functions.