
Catalog Number	AR00IBA2
Chemical Name	1-Pyrrolidinecarboxylic acid, 3,4-dihydroxy-, phenylmethyl ester,(3S,4S)-
CAS Number	596793-30-5
Molecular Formula	C12H15NO4
Molecular Weight	237.2518
MDL Number	MFCD11109737
SMILES	O[C@H]1CN(C[C@@H]1O)C(=O)OCc1ccccc1

(3S,4S)-Benzyl 3,4-dihydroxypyrrolidine-1-carboxylate is a versatile compound that finds significant application in chemical synthesis. Its unique structural features make it a valuable building block in the production of various organic molecules.One of the key applications of (3S,4S)-Benzyl 3,4-dihydroxypyrrolidine-1-carboxylate is in the synthesis of pharmaceutical intermediates. This compound can serve as a chiral auxiliary, imparting stereochemical control in the formation of complex molecules. Its presence in the synthesis pathway can influence the stereochemistry of the final product, ensuring the desired three-dimensional arrangement.Furthermore, (3S,4S)-Benzyl 3,4-dihydroxypyrrolidine-1-carboxylate can be utilized in the construction of natural product derivatives, providing access to compounds with biological activity. By incorporating this building block into the molecular framework, chemists can facilitate the creation of novel structures with potential therapeutic properties.In summary, the application of (3S,4S)-Benzyl 3,4-dihydroxypyrrolidine-1-carboxylate in chemical synthesis extends to the synthesis of pharmaceutical intermediates and natural product derivatives, offering opportunities for the development of valuable compounds with diverse functionalities and applications.