
Catalog Number	AR00EDL1
Chemical Name	3-Amino-6-methylthieno[2,3-b]pyridine-2-carboxylic acid
CAS Number	59488-60-7
Molecular Formula	C9H8N2O2S
Molecular Weight	208.237
MDL Number	MFCD00716636
SMILES	Cc1ccc2c(n1)sc(c2N)C(=O)O

3-Amino-6-methylthieno[2,3-b]pyridine-2-carboxylic acid, also known as $name$, serves as a versatile building block in chemical synthesis due to its unique structure and reactivity. This compound is commonly employed in the development of pharmaceutical intermediates and active pharmaceutical ingredients (APIs). Its amino and carboxylic acid functional groups allow for facile derivatization and incorporation into various molecular scaffolds. In organic synthesis, $name$ can be utilized as a key starting material for the synthesis of heterocyclic compounds, which are prevalent in medicinal chemistry. Its presence in drug discovery research highlights its significance in the creation of novel chemical entities with potential therapeutic applications. Additionally, the selective modification of $name$ enables the introduction of diverse substituents, leading to the creation of analogs for structure-activity relationship (SAR) studies, ultimately aiding in the optimization of drug candidates.