
Catalog Number	AR00EF73
Chemical Name	5-Hydroxy-6-nitropyridine-3-carboxylic acid
CAS Number	59288-43-6
Molecular Formula	C6H4N2O5
Molecular Weight	184.1064
MDL Number	MFCD11044358
SMILES	[O-][N+](=O)c1ncc(cc1O)C(=O)O

5-Hydroxy-6-nitronicotinic acid is a versatile compound that finds its application in various chemical synthesis processes. This compound is particularly valuable in the production of pharmaceuticals, agrochemicals, and specialty chemicals. Its unique structure and reactivity make it an important building block in organic synthesis.In chemical synthesis, 5-Hydroxy-6-nitronicotinic acid can be used as a key intermediate in the preparation of complex molecules. Its functional groups enable facile functionalization and allow for the introduction of specific chemical moieties at strategic positions. This versatility makes it a valuable tool for chemists working on the synthesis of novel compounds with desired properties.Furthermore, 5-Hydroxy-6-nitronicotinic acid can serve as a precursor for the synthesis of heterocyclic compounds, which are common motifs found in many biologically active molecules. By incorporating this compound into synthetic pathways, chemists can access a wide range of structurally diverse compounds with potential applications in medicine, agriculture, and materials science.Overall, the application of 5-Hydroxy-6-nitronicotinic acid in chemical synthesis offers chemists a powerful tool for designing and constructing complex molecules with tailored properties and functions. Its role as a versatile building block underscores its importance in the field of organic chemistry and underscores its value as a key component in the synthesis of diverse chemical compounds.